771-51-7 3-Indolylacetonitrile
| product Name |
3-Indolylacetonitrile |
| CAS No |
771-51-7 |
| Synonyms |
Indole-3-acetonitrile,(Indolyl-3-acetonitrile); Indolyl-3-acetonitrile; Indole-3-acetonitrile; 1H-Indole-3-acetonitrile; BETA-INDOLYLACETONITRILE; 2-(1H-INDOL-3-YL)ACETONITRILE; (1H-INDOL-3-YL)-ACETONITRILE; 3-INDOLEACETONITRILE; 3-Indole acetonitrile |
| Molecular Formula |
C10H8N2 |
| Molecular Weight |
156.18 |
| InChI |
InChI=1/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
| EINECS |
212-232-1 |
| Molecular Structure |
|
| Density |
158 |
| Melting point |
33-35℃ |
| Boiling point |
156-160℃(0.2 torr) |
| Refractive index |
1.6085-1.6105 |
| Flash point |
206℃ |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Miss Lu |
| Telephone |
+86-573-84183630 |
| Email |
jinlu@chengdapharm.com |
| Address |
NO.36, Huanghe Road, Huimin District, Jiashan, Zhejiang, China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
| Contact |
Eileen |
| Telephone |
+86-21- 66298965 |
| Email |
syzmm@hotmail.com |
| Address |
Room 101, No.2, 588 Street Liuying Road, Zhabei District, Shanghai |
| Contact |
Miss zheng |
| Telephone |
+86-755-26408073/26408072 |
| Email |
billiken@billikenchem.com |
| Address |
Unit 04,26F,Yihai Square East,No.90 Chuangye Road,Shenzhen,China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-85095566;18969113688 |
| Email |
sales@nwchemical.com |
| Address |
Room 803, Qinglian Bldg, No 139 Qingchun Road, Hangzhou, Zhejiang China |