ChemNet > CAS > 6277-38-9 4-Methoxy-3-nitroacetophenone
6277-38-9 4-Methoxy-3-nitroacetophenone
| Nome do produto |
4-Methoxy-3-nitroacetophenone |
| Nome em inglês |
4-Methoxy-3-nitroacetophenone;1-(4-Methoxy-3-nitrophenyl)ethan-1-one; 1-(4-methoxy-3-nitrophenyl)ethanone |
| Fórmula molecular |
C9H9NO4 |
| Peso Molecular |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-6(11)7-3-4-9(14-2)8(5-7)10(12)13/h3-5H,1-2H3 |
| CAS Registry Number |
6277-38-9 |
| EINECS |
228-476-7 |
| Estrutura Molecular |
|
| Densidade |
1.244g/cm3 |
| Ponto de ebuli??o |
315.1°C at 760 mmHg |
| índice de refra??o |
1.544 |
| O ponto de inflama??o |
148.2°C |
| Press?o de vapor |
0.000448mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|