ChemNet > CAS > 6277-38-9 4-Methoxy-3-nitroacetophenone
6277-38-9 4-Methoxy-3-nitroacetophenone
| Naam product |
4-Methoxy-3-nitroacetophenone |
| Engelse naam |
4-Methoxy-3-nitroacetophenone;1-(4-Methoxy-3-nitrophenyl)ethan-1-one; 1-(4-methoxy-3-nitrophenyl)ethanone |
| MF |
C9H9NO4 |
| Molecuulgewicht |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-6(11)7-3-4-9(14-2)8(5-7)10(12)13/h3-5H,1-2H3 |
| CAS-nummer |
6277-38-9 |
| EINECS |
228-476-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.244g/cm3 |
| Kookpunt |
315.1°C at 760 mmHg |
| Brekingsindex |
1.544 |
| Vlampunt |
148.2°C |
| Dampdruk |
0.000448mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|