5239-82-7 Cyclopropylacetic acid
| Nome do produto |
Cyclopropylacetic acid |
| Nome em inglês |
Cyclopropylacetic acid;Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
| Fórmula molecular |
C8H20B2N6S |
| Peso Molecular |
253.9716 |
| InChI |
InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
| CAS Registry Number |
5239-82-7 |
| Estrutura Molecular |
|
| Densidade |
1.16g/cm3 |
| Ponto de ebuli??o |
293°C at 760 mmHg |
| índice de refra??o |
1.584 |
| O ponto de inflama??o |
131°C |
| Press?o de vapor |
0.00177mmHg at 25°C |
| Códigos de risco |
R34:Causes burns.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|