5239-82-7 Cyclopropylacetic acid
| Nome del prodotto |
Cyclopropylacetic acid |
| Nome inglese |
Cyclopropylacetic acid;Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
| Formula molecolare |
C8H20B2N6S |
| Peso Molecolare |
253.9716 |
| InChI |
InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
| Numero CAS |
5239-82-7 |
| Struttura molecolare |
|
| Densità |
1.16g/cm3 |
| Punto di ebollizione |
293°C at 760 mmHg |
| Indice di rifrazione |
1.584 |
| Punto d'infiammabilità |
131°C |
| Pressione di vapore |
0.00177mmHg at 25°C |
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|