3007-97-4 ethyl 1-naphthoate
| Nome do produto |
ethyl 1-naphthoate |
| Nome em inglês |
ethyl 1-naphthoate; Ethyl 1-naphthoate, (1-Naphthoic acid ethyl es; 1-Naphthoic acid ethyl ester; Ethyl1-naphthoate, (1-Naphthoicacidethylester); ethyl naphthalene-1-carboxylate |
| Fórmula molecular |
C13H12O2 |
| Peso Molecular |
200.2332 |
| InChI |
InChI=1/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| CAS Registry Number |
3007-97-4 |
| EINECS |
221-120-1 |
| Estrutura Molecular |
|
| Densidade |
1.125g/cm3 |
| Ponto de ebuli??o |
310°C at 760 mmHg |
| índice de refra??o |
1.595 |
| O ponto de inflama??o |
148.7°C |
| Press?o de vapor |
0.000617mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|