3007-97-4 ethyl 1-naphthoate
| product Name |
ethyl 1-naphthoate |
| CAS No |
3007-97-4 |
| Synonyms |
Ethyl 1-naphthoate, (1-Naphthoic acid ethyl es; 1-Naphthoic acid ethyl ester; Ethyl1-naphthoate, (1-Naphthoicacidethylester); ethyl naphthalene-1-carboxylate |
| Molecular Formula |
C13H12O2 |
| Molecular Weight |
200.2332 |
| InChI |
InChI=1/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| EINECS |
221-120-1 |
| Molecular Structure |
|
| Density |
1.125g/cm3 |
| Boiling point |
310°C at 760 mmHg |
| Refractive index |
1.595 |
| Flash point |
148.7°C |
| Vapour Pressur |
0.000617mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|