ChemNet > CAS > 28229-69-8 3-Bromophenethylalcohol
28229-69-8 3-Bromophenethylalcohol
| Nome do produto |
3-Bromophenethylalcohol |
| Nome em inglês |
3-Bromophenethylalcohol; 2-(3-Bromophenyl)-ethanol; 3-Bromophenethylacohol; 3-bromobenzeneethanol; 3-bromophenethyl alcohol; m-bromobenzeneethanol |
| Fórmula molecular |
C8H9BrO |
| Peso Molecular |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| CAS Registry Number |
28229-69-8 |
| Estrutura Molecular |
|
| Densidade |
1.479g/cm3 |
| Ponto de ebuli??o |
274.6°C at 760 mmHg |
| índice de refra??o |
1.576 |
| O ponto de inflama??o |
119.9°C |
| Press?o de vapor |
0.00259mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|