ChemNet > CAS > 28229-69-8 3-Bromophenethylalcohol
28229-69-8 3-Bromophenethylalcohol
| Produkt-Name |
3-Bromophenethylalcohol |
| Englischer Name |
3-Bromophenethylalcohol; 2-(3-Bromophenyl)-ethanol; 3-Bromophenethylacohol; 3-bromobenzeneethanol; 3-bromophenethyl alcohol; m-bromobenzeneethanol |
| Molekulare Formel |
C8H9BrO |
| Molecular Weight |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| CAS Registry Number |
28229-69-8 |
| Molecular Structure |
|
| Dichte |
1.479g/cm3 |
| Siedepunkt |
274.6°C at 760 mmHg |
| Brechungsindex |
1.576 |
| Flammpunkt |
119.9°C |
| Dampfdruck |
0.00259mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|