2393-17-1 Aminohydrocinnamicacid
| Nome do produto |
Aminohydrocinnamicacid |
| Nome em inglês |
Aminohydrocinnamicacid; 4-Aminohydrocinnamic acid; 3-(4-aminophenyl)propanoic acid |
| Fórmula molecular |
C9H11NO2 |
| Peso Molecular |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6,10H2,(H,11,12) |
| CAS Registry Number |
2393-17-1 |
| EINECS |
219-245-1 |
| Estrutura Molecular |
|
| Densidade |
1.217g/cm3 |
| Ponto de ebuli??o |
351°C at 760 mmHg |
| índice de refra??o |
1.597 |
| O ponto de inflama??o |
166.1°C |
| Press?o de vapor |
1.57E-05mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|