2393-17-1 Aminohydrocinnamicacid
| product Name |
Aminohydrocinnamicacid |
| CAS No |
2393-17-1 |
| Synonyms |
4-Aminohydrocinnamic acid; 3-(4-aminophenyl)propanoic acid |
| Molecular Formula |
C9H11NO2 |
| Molecular Weight |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6,10H2,(H,11,12) |
| EINECS |
219-245-1 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
351°C at 760 mmHg |
| Refractive index |
1.597 |
| Flash point |
166.1°C |
| Vapour Pressur |
1.57E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |