ChemNet > CAS > 4771-50-0 7-methylindole 3-carboxaldehyde
4771-50-0 7-methylindole 3-carboxaldehyde
| Nazwa produktu: |
7-methylindole 3-carboxaldehyde |
| Angielska nazwa |
7-methylindole 3-carboxaldehyde; 7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
| MF |
C10H9NO |
| Masie cz?steczkowej |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
| Nr CAS |
4771-50-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.226g/cm3 |
| Temperatura wrzenia |
341°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.698 |
| Temperatura zap?onu |
168°C |
| Ci?nienie pary |
8.31E-05mmHg at 25°C |
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|