ChemNet > CAS > 4771-50-0 7-methylindole 3-carboxaldehyde
4771-50-0 7-methylindole 3-carboxaldehyde
| Ονομασ?α του προ??ντο? |
7-methylindole 3-carboxaldehyde |
| Αγγλικ? ?νομα |
7-methylindole 3-carboxaldehyde; 7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
| MF |
C10H9NO |
| Μοριακ? β?ρο? |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
| CAS ΟΧΙ |
4771-50-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.226g/cm3 |
| Σημε?ο βρασμο? |
341°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.698 |
| Σημε?ο αν?φλεξη? |
168°C |
| Π?εση ατμ?ν |
8.31E-05mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|