ChemNet > CAS > 2586-62-1 1-Bromo-2-methylnaphthalene
2586-62-1 1-Bromo-2-methylnaphthalene
| Nazwa produktu: |
1-Bromo-2-methylnaphthalene |
| Angielska nazwa |
1-Bromo-2-methylnaphthalene; 1-Bromo-2-methylnaphtalene |
| MF |
C11H9Br |
| Masie cz?steczkowej |
221.0932 |
| InChI |
InChI=1/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
| Nr CAS |
2586-62-1 |
| EINECS |
219-966-1 |
| Struktury molekularnej |
|
| G?sto?? |
1.417g/cm3 |
| Temperatura wrzenia |
300.9°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.645 |
| Temperatura zap?onu |
137.4°C |
| Ci?nienie pary |
0.00195mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|