ChemNet > CAS > 2586-62-1 1-Bromo-2-methylnaphthalene
2586-62-1 1-Bromo-2-methylnaphthalene
| Produkt-Name |
1-Bromo-2-methylnaphthalene |
| Englischer Name |
1-Bromo-2-methylnaphthalene; 1-Bromo-2-methylnaphtalene |
| Molekulare Formel |
C11H9Br |
| Molecular Weight |
221.0932 |
| InChI |
InChI=1/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
| CAS Registry Number |
2586-62-1 |
| EINECS |
219-966-1 |
| Molecular Structure |
|
| Dichte |
1.417g/cm3 |
| Siedepunkt |
300.9°C at 760 mmHg |
| Brechungsindex |
1.645 |
| Flammpunkt |
137.4°C |
| Dampfdruck |
0.00195mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|