ChemNet > CAS > 2396-85-2 trans-2-oktenoesan metylu
2396-85-2 trans-2-oktenoesan metylu
| Nazwa produktu: |
trans-2-oktenoesan metylu |
| Synonimy |
219-259-8; okt-2-enian metylu; metylo(2E)-okt-2-enonian |
| Angielska nazwa |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| MF |
C9H16O2 |
| Masie cz?steczkowej |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| Nr CAS |
2396-85-2 |
| EINECS |
219-259-8 |
| Struktury molekularnej |
|
| G?sto?? |
0.896g/cm3 |
| Temperatura wrzenia |
194.6°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.436 |
| Temperatura zap?onu |
82.8°C |
| Ci?nienie pary |
0.437mmHg at 25°C |
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|