2396-85-2 ???? ????-2-????????
| ?? ????? |
???? ????-2-???????? |
| ?????? |
; 219-259-8; ???? oct-2-enoate; ???? (2E)-oct-2-enoate |
| ?? ????? |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| ????????? ??????? |
C9H16O2 |
| ???? ???????? |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| ???? CAS |
2396-85-2 |
| EINECS |
219-259-8 |
| ???? ???????? |
|
| ?????? |
0.896g/cm3 |
| ????? ????? |
194.6°C at 760 mmHg |
| ???? ????? |
1.436 |
| ????? ???? |
82.8°C |
| ??? ???? |
0.437mmHg at 25°C |
| ??????? ???? |
R36/38:Irritating to eyes and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|