2396-85-2 Methyl-trans-2-octenoat
| Produkt-Name |
Methyl-trans-2-octenoat |
| Synonyme |
219-259-8; Methyl-Oct-2-enoat; Methyl(2E)-oct-2-enoat |
| Englischer Name |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| Molekulare Formel |
C9H16O2 |
| Molecular Weight |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| CAS Registry Number |
2396-85-2 |
| EINECS |
219-259-8 |
| Molecular Structure |
|
| Dichte |
0.896g/cm3 |
| Siedepunkt |
194.6°C at 760 mmHg |
| Brechungsindex |
1.436 |
| Flammpunkt |
82.8°C |
| Dampfdruck |
0.437mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|