2050-23-9 Diethyl suberate
| Nazwa produktu: |
Diethyl suberate |
| Angielska nazwa |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| MF |
C12H22O4 |
| Masie cz?steczkowej |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| Nr CAS |
2050-23-9 |
| EINECS |
218-084-4 |
| Struktury molekularnej |
|
| G?sto?? |
0.985g/cm3 |
| Temperatura topnienia |
5-284℃ |
| Temperatura wrzenia |
282.6°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.436 |
| Temperatura zap?onu |
123.3°C |
| Ci?nienie pary |
0.00332mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|