2050-23-9 Diethyl suberate
| termék neve |
Diethyl suberate |
| Angol név |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| MF |
C12H22O4 |
| Molekulat?meg |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| CAS-szám |
2050-23-9 |
| EINECS |
218-084-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.985g/cm3 |
| Olvadáspont |
5-284℃ |
| Forráspont |
282.6°C at 760 mmHg |
| T?résmutató |
1.436 |
| Gyulladáspont |
123.3°C |
| G?znyomás |
0.00332mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|