1871-67-6 2-Octenoic acid
| Nazwa produktu: |
2-Octenoic acid |
| Angielska nazwa |
2-Octenoic acid; Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
| MF |
C8H13O2 |
| Masie cz?steczkowej |
141.1882 |
| InChI |
InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
| Nr CAS |
1871-67-6 |
| EINECS |
217-491-4 |
| Struktury molekularnej |
|
| Temperatura topnienia |
5-6℃ |
| Temperatura wrzenia |
260.2°C at 760 mmHg |
| Temperatura zap?onu |
151.1°C |
| Ci?nienie pary |
0.0037mmHg at 25°C |
| Symbole zagro?enia |
C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|