1871-67-6 2-Octenoic acid
| product Name |
2-Octenoic acid |
| CAS No |
1871-67-6 |
| Synonyms |
Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
| Molecular Formula |
C8H13O2 |
| Molecular Weight |
141.1882 |
| InChI |
InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
| EINECS |
217-491-4 |
| Molecular Structure |
|
| Melting point |
5-6℃ |
| Boiling point |
260.2°C at 760 mmHg |
| Flash point |
151.1°C |
| Vapour Pressur |
0.0037mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Lucky Liu |
| Telephone |
0086-15665710862 |
| Email |
sales@tzrunlong.com |
| Address |
No. 78, Fushan Road, Biomedical Industrial Park, Dawu Town, Tengzhou, Shandong, 277514 China |