ChemNet > CAS > 952-97-6 4-Nitrophenyl phenyl sulfide
952-97-6 4-Nitrophenyl phenyl sulfide
| produktnavn |
4-Nitrophenyl phenyl sulfide |
| Engelsk navn |
4-Nitrophenyl phenyl sulfide; 4-Nitrodiphenyl Sulfide; 1-nitro-4-(phenylsulfanyl)benzene |
| Molekyl?r Formel |
C12H9NO2S |
| Molekylvekt |
231.2704 |
| InChI |
InChI=1/C12H9NO2S/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H |
| CAS-nummer |
952-97-6 |
| EINECS |
213-462-5 |
| Molecular Structure |
|
| Tetthet |
1.31g/cm3 |
| Smeltepunkt |
54-58℃ |
| Kokepunkt |
396.8°C at 760 mmHg |
| Brytningsindeks |
1.665 |
| Flammepunktet |
193.8°C |
| Damptrykk |
3.8E-06mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|