ChemNet > CAS > 952-97-6 4-Nitrophenyl phenyl sulfide
952-97-6 4-Nitrophenyl phenyl sulfide
| product Name |
4-Nitrophenyl phenyl sulfide |
| CAS No |
952-97-6 |
| Synonyms |
4-Nitrodiphenyl Sulfide; 1-nitro-4-(phenylsulfanyl)benzene |
| Molecular Formula |
C12H9NO2S |
| Molecular Weight |
231.2704 |
| InChI |
InChI=1/C12H9NO2S/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H |
| EINECS |
213-462-5 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
54-58℃ |
| Boiling point |
396.8°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
193.8°C |
| Vapour Pressur |
3.8E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|