617-02-7 o-Tolyl benzoate
| produktnavn |
o-Tolyl benzoate |
| Engelsk navn |
o-Tolyl benzoate; o-Tolyl benzoate (Benzoic acid o-tolyl ester); Benzoic acid o-tolyl ester; 2-methylphenyl benzoate |
| Molekyl?r Formel |
C14H12O2 |
| Molekylvekt |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| CAS-nummer |
617-02-7 |
| EINECS |
210-501-8 |
| Molecular Structure |
|
| Tetthet |
1.122g/cm3 |
| Kokepunkt |
368.9°C at 760 mmHg |
| Brytningsindeks |
1.577 |
| Flammepunktet |
154.5°C |
| Damptrykk |
1.23E-05mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|