617-02-7 o-Tolyl benzoate
| Nome del prodotto |
o-Tolyl benzoate |
| Nome inglese |
o-Tolyl benzoate; o-Tolyl benzoate (Benzoic acid o-tolyl ester); Benzoic acid o-tolyl ester; 2-methylphenyl benzoate |
| Formula molecolare |
C14H12O2 |
| Peso Molecolare |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| Numero CAS |
617-02-7 |
| EINECS |
210-501-8 |
| Struttura molecolare |
|
| Densità |
1.122g/cm3 |
| Punto di ebollizione |
368.9°C at 760 mmHg |
| Indice di rifrazione |
1.577 |
| Punto d'infiammabilità |
154.5°C |
| Pressione di vapore |
1.23E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|