ChemNet > CAS > 5773-80-8 6-bromo-2-naphthoic acid
5773-80-8 6-bromo-2-naphthoic acid
| produktnavn |
6-bromo-2-naphthoic acid |
| Engelsk navn |
6-bromo-2-naphthoic acid; 2-naphthalenecarboxylic acid, 6-bromo-; 6-Bromo-2-naphthoicacid; 6-bromonaphthalene-2-carboxylic acid; 6-Bromo-2-naphthoicacid,96%; 6-BROMO-2-NAPHTHOIC ACID 99%; 6-bromo-2-Naphthalenecarboxylic acid |
| Molekyl?r Formel |
C11H7BrO2 |
| Molekylvekt |
251.0761 |
| InChI |
InChI=1/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| CAS-nummer |
5773-80-8 |
| Molecular Structure |
|
| Tetthet |
1.648g/cm3 |
| Smeltepunkt |
294-295℃ |
| Kokepunkt |
387.3°C at 760 mmHg |
| Brytningsindeks |
1.697 |
| Flammepunktet |
188°C |
| Damptrykk |
1.08E-06mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|