ChemNet > CAS > 5773-80-8 6-bromo-2-naphthoic acid
5773-80-8 6-bromo-2-naphthoic acid
| Produkt-Name |
6-bromo-2-naphthoic acid |
| Englischer Name |
6-bromo-2-naphthoic acid; 2-naphthalenecarboxylic acid, 6-bromo-; 6-Bromo-2-naphthoicacid; 6-bromonaphthalene-2-carboxylic acid; 6-Bromo-2-naphthoicacid,96%; 6-BROMO-2-NAPHTHOIC ACID 99%; 6-bromo-2-Naphthalenecarboxylic acid |
| Molekulare Formel |
C11H7BrO2 |
| Molecular Weight |
251.0761 |
| InChI |
InChI=1/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| CAS Registry Number |
5773-80-8 |
| Molecular Structure |
|
| Dichte |
1.648g/cm3 |
| Schmelzpunkt |
294-295℃ |
| Siedepunkt |
387.3°C at 760 mmHg |
| Brechungsindex |
1.697 |
| Flammpunkt |
188°C |
| Dampfdruck |
1.08E-06mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|