2563-07-7 2-Ethoxy-p-cresol
| produktnavn |
2-Ethoxy-p-cresol |
| Engelsk navn |
2-Ethoxy-p-cresol; 2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
| Molekyl?r Formel |
C9H12O2 |
| Molekylvekt |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
| CAS-nummer |
2563-07-7 |
| Molecular Structure |
|
| Tetthet |
1.052g/cm3 |
| Kokepunkt |
243.7°C at 760 mmHg |
| Brytningsindeks |
1.524 |
| Flammepunktet |
105°C |
| Damptrykk |
0.0203mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|