2563-07-7 2-Ethoxy-p-cresol
| Nama produk |
2-Ethoxy-p-cresol |
| Nama bahasa Inggris |
2-Ethoxy-p-cresol; 2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
| MF |
C9H12O2 |
| Berat Molekul |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
| CAS NO |
2563-07-7 |
| Struktur Molekul |
|
| Kepadatan |
1.052g/cm3 |
| Titik didih |
243.7°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
105°C |
| Tekanan uap |
0.0203mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|