| Naam product |
melamine cyanurate |
| Engelse naam |
melamine cyanurate; Melamine cyanurate(1:1); Non-halogen flame-retardant MPP; 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 1,3,5-triazine-2,4,6-triamine (1:1); 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compound with 1,3,5-triazine-2,4,6-triamine (1:1); s-Triazine, 2,4,6-triamino-, compd. with s-triazine-triol; Melamine isocyanurate; Melamine-cyanuric acid compd; Melaminkyanurat; Melamine Cyanurate(MCA) |
| MF |
C6H9N9O3 |
| Molecuulgewicht |
255.20 |
| InChI |
InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9) |
| CAS-nummer |
37640-57-6 |
| EINECS |
253-575-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.70g/cm3 |
| Smeltpunt |
350℃ (dec.) |
| Kookpunt |
388.7°C at 760 mmHg |
| Brekingsindex |
1.571 |
| Vlampunt |
188.9°C |
| Oplosbaarheid in water |
insoluble |
| Dampdruk |
1.2E-07mmHg at 25°C |
|