| ???? |
melamine cyanurate |
| ?? ?? |
melamine cyanurate; Melamine cyanurate(1:1); Non-halogen flame-retardant MPP; 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 1,3,5-triazine-2,4,6-triamine (1:1); 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compound with 1,3,5-triazine-2,4,6-triamine (1:1); s-Triazine, 2,4,6-triamino-, compd. with s-triazine-triol; Melamine isocyanurate; Melamine-cyanuric acid compd; Melaminkyanurat; Melamine Cyanurate(MCA) |
| ??? |
C6H9N9O3 |
| ??? |
255.20 |
| InChI |
InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9) |
| cas?? |
37640-57-6 |
| EC?? |
253-575-7 |
| ?? ?? |
|
| ?? |
1.70g/cm3 |
| ?? ? |
350℃ (dec.) |
| ??? |
388.7°C at 760 mmHg |
| ?? ?? |
1.571 |
| ??? |
188.9°C |
| ? ??? |
insoluble |
| ??? |
1.2E-07mmHg at 25°C |
|