779-51-1 alpha-Methylstilbene
| Nama produk |
alpha-Methylstilbene |
| Nama Inggeris |
alpha-Methylstilbene;1,2-Diphenylpropene; 1,2-Diphenyl-1-propene; 1-Methyl-1,2-diphenylethene; 1-Propene, 1,2-diphenyl-; NSC 70; Benzene, 1,1'-(1-methyl-1,2-ethenediyl)bis- (9CI); Stilbene, alpha-methyl- (8CI); 1,1'-prop-1-ene-1,2-diyldibenzene; 1,1'-(1E)-prop-1-ene-1,2-diyldibenzene |
| MF |
C15H14 |
| Berat Molekul |
194.2717 |
| InChI |
InChI=1/C15H14/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3/b13-12+ |
| CAS NO |
779-51-1 |
| EINECS |
212-300-0 |
| Struktur Molekul |
|
| Kepadatan |
1.009g/cm3 |
| Titik didih |
282.5°C at 760 mmHg |
| Indeks bias |
1.612 |
| Titik nyala |
124.5°C |
| Tekanan wap |
0.00571mmHg at 25°C |
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|