779-51-1 alpha-Methylstilbene
| termék neve |
alpha-Methylstilbene |
| Angol név |
alpha-Methylstilbene;1,2-Diphenylpropene; 1,2-Diphenyl-1-propene; 1-Methyl-1,2-diphenylethene; 1-Propene, 1,2-diphenyl-; NSC 70; Benzene, 1,1'-(1-methyl-1,2-ethenediyl)bis- (9CI); Stilbene, alpha-methyl- (8CI); 1,1'-prop-1-ene-1,2-diyldibenzene; 1,1'-(1E)-prop-1-ene-1,2-diyldibenzene |
| MF |
C15H14 |
| Molekulat?meg |
194.2717 |
| InChI |
InChI=1/C15H14/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3/b13-12+ |
| CAS-szám |
779-51-1 |
| EINECS |
212-300-0 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.009g/cm3 |
| Forráspont |
282.5°C at 760 mmHg |
| T?résmutató |
1.612 |
| Gyulladáspont |
124.5°C |
| G?znyomás |
0.00571mmHg at 25°C |
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|