70-69-9 4'-Aminopropiophenone
| Nama produk |
4'-Aminopropiophenone |
| Nama Inggeris |
4'-Aminopropiophenone; 4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
| MF |
C9H11NO |
| Berat Molekul |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS NO |
70-69-9 |
| EINECS |
200-742-7 |
| Struktur Molekul |
|
| Kepadatan |
1.067g/cm3 |
| Titik lebur |
137-143℃ |
| Titik didih |
305.8°C at 760 mmHg |
| Indeks bias |
1.559 |
| Titik nyala |
138.7°C |
| Tekanan wap |
0.000805mmHg at 25°C |
| Cinta bahaya |
T:Toxic;
|
| Kod Risiko |
R25:Toxic if swallowed.;
|
| Keselamatan Penerangan |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|