70-69-9 4'-Aminopropiophenone
| Produkt-Name |
4'-Aminopropiophenone |
| Englischer Name |
4'-Aminopropiophenone; 4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
| Molekulare Formel |
C9H11NO |
| Molecular Weight |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS Registry Number |
70-69-9 |
| EINECS |
200-742-7 |
| Molecular Structure |
|
| Dichte |
1.067g/cm3 |
| Schmelzpunkt |
137-143℃ |
| Siedepunkt |
305.8°C at 760 mmHg |
| Brechungsindex |
1.559 |
| Flammpunkt |
138.7°C |
| Dampfdruck |
0.000805mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Beschreibung |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|