ChemNet > CAS > 18640-58-9 4'-Bromo-3'-nitroacetophenone
18640-58-9 4'-Bromo-3'-nitroacetophenone
| Nama produk |
4'-Bromo-3'-nitroacetophenone |
| Nama Inggeris |
4'-Bromo-3'-nitroacetophenone; 4-Bromo-3-nitroacetophenone; 4'-Bromo-3'-nitroacetophenone; 1-(4-Bromo-3-nitrophenyl)-ethan-1-one; 1-(4-bromo-3-nitrophenyl)ethanone |
| MF |
C8H6BrNO3 |
| Berat Molekul |
244.0421 |
| InChI |
InChI=1/C8H6BrNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| CAS NO |
18640-58-9 |
| EINECS |
242-469-6 |
| Struktur Molekul |
|
| Kepadatan |
1.637g/cm3 |
| Titik lebur |
118-120℃ |
| Titik didih |
275.4°C at 760 mmHg |
| Indeks bias |
1.593 |
| Titik nyala |
120.4°C |
| Tekanan wap |
0.00511mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|