ChemNet > CAS > 18640-58-9 4'-Bromo-3'-nitroacetophenone
18640-58-9 4'-Bromo-3'-nitroacetophenone
| Nome del prodotto |
4'-Bromo-3'-nitroacetophenone |
| Nome inglese |
4'-Bromo-3'-nitroacetophenone; 4-Bromo-3-nitroacetophenone; 4'-Bromo-3'-nitroacetophenone; 1-(4-Bromo-3-nitrophenyl)-ethan-1-one; 1-(4-bromo-3-nitrophenyl)ethanone |
| Formula molecolare |
C8H6BrNO3 |
| Peso Molecolare |
244.0421 |
| InChI |
InChI=1/C8H6BrNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| Numero CAS |
18640-58-9 |
| EINECS |
242-469-6 |
| Struttura molecolare |
|
| Densità |
1.637g/cm3 |
| Punto di fusione |
118-120℃ |
| Punto di ebollizione |
275.4°C at 760 mmHg |
| Indice di rifrazione |
1.593 |
| Punto d'infiammabilità |
120.4°C |
| Pressione di vapore |
0.00511mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|