ChemNet > CAS > 491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
| ???? |
4'-Methoxy-3,5,7-trihydroxyflavone |
| ?? ?? |
4'-Methoxy-3,5,7-trihydroxyflavone; Kaempferide; 3,5,7-Trihydroxy-4-methoxyflavone; 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| ??? |
C16H12O6 |
| ??? |
300.2629 |
| InChI |
InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| cas?? |
491-54-3 |
| EC?? |
207-738-4 |
| ?? ?? |
|
| ?? |
1.538g/cm3 |
| ??? |
543.8°C at 760 mmHg |
| ?? ?? |
1.709 |
| ??? |
207.1°C |
| ??? |
1.94E-12mmHg at 25°C |
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|