ChemNet > CAS > 491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
| Produkt-Name |
4'-Methoxy-3,5,7-trihydroxyflavone |
| Englischer Name |
4'-Methoxy-3,5,7-trihydroxyflavone; Kaempferide; 3,5,7-Trihydroxy-4-methoxyflavone; 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Molekulare Formel |
C16H12O6 |
| Molecular Weight |
300.2629 |
| InChI |
InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| CAS Registry Number |
491-54-3 |
| EINECS |
207-738-4 |
| Molecular Structure |
|
| Dichte |
1.538g/cm3 |
| Siedepunkt |
543.8°C at 760 mmHg |
| Brechungsindex |
1.709 |
| Flammpunkt |
207.1°C |
| Dampfdruck |
1.94E-12mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|