94-81-5 MCPB
| Nome del prodotto |
MCPB |
| Nome inglese |
MCPB; 4-(4-Chloro-o-tolyloxy)butyric acid; 2,4-MCPB; 4-(4-Chloro-2-methylphenoxy)butyric acid; MCPB; 4-(2-Methyl-4-chlorophenoxy)butyric acid; 2-(4-chloro-2-methylphenoxy)butanoic acid |
| Formula molecolare |
C11H13ClO3 |
| Peso Molecolare |
228.6721 |
| InChI |
InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
| Numero CAS |
94-81-5 |
| EINECS |
202-365-3 |
| Struttura molecolare |
|
| Densità |
1.228g/cm3 |
| Punto di ebollizione |
345.1°C at 760 mmHg |
| Indice di rifrazione |
1.536 |
| Punto d'infiammabilità |
162.5°C |
| Pressione di vapore |
2.39E-05mmHg at 25°C |
| Codici di Rischio |
R22:Harmful if swallowed.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|