94-81-5 MCPB
| product Name |
MCPB |
| CAS No |
94-81-5 |
| Synonyms |
4-(4-Chloro-o-tolyloxy)butyric acid; 2,4-MCPB; 4-(4-Chloro-2-methylphenoxy)butyric acid; MCPB; 4-(2-Methyl-4-chlorophenoxy)butyric acid; 2-(4-chloro-2-methylphenoxy)butanoic acid |
| Molecular Formula |
C11H13ClO3 |
| Molecular Weight |
228.6721 |
| InChI |
InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
| EINECS |
202-365-3 |
| Molecular Structure |
|
| Density |
1.228g/cm3 |
| Boiling point |
345.1°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
162.5°C |
| Vapour Pressur |
2.39E-05mmHg at 25°C |
| Risk Codes |
R22:Harmful if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|