55751-54-7 2-sec-butylaniline
| Nome del prodotto |
2-sec-butylaniline |
| Nome inglese |
2-sec-butylaniline; Benzenamine, 2-(1-methylpropyl)-; 2-sec-Butylaniline; 2-(butan-2-yl)aniline; 2-(sec-Butyl)aniline |
| Formula molecolare |
C10H15N |
| Peso Molecolare |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8H,3,11H2,1-2H3 |
| Numero CAS |
55751-54-7 |
| EINECS |
259-794-4 |
| Struttura molecolare |
|
| Densità |
0.942g/cm3 |
| Punto di ebollizione |
239°C at 760 mmHg |
| Indice di rifrazione |
1.535 |
| Punto d'infiammabilità |
101.5°C |
| Pressione di vapore |
0.0412mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|