55751-54-7 2-sec-butylaniline
| product Name |
2-sec-butylaniline |
| CAS No |
55751-54-7 |
| Synonyms |
Benzenamine, 2-(1-methylpropyl)-; 2-sec-Butylaniline; 2-(butan-2-yl)aniline; 2-(sec-Butyl)aniline |
| Molecular Formula |
C10H15N |
| Molecular Weight |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8H,3,11H2,1-2H3 |
| EINECS |
259-794-4 |
| Molecular Structure |
|
| Density |
0.942g/cm3 |
| Boiling point |
239°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
101.5°C |
| Vapour Pressur |
0.0412mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |