497-37-0 exo-(±)-Norborneol
| Nome del prodotto |
exo-(±)-Norborneol |
| Nome inglese |
exo-(±)-Norborneol; 2-exo-Norborneol; exo-Norborneol; (1R,2R,4S)-bicyclo[2.2.1]heptan-2-ol; (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol; (2S,4R)-bicyclo[2.2.1]heptan-2-amine |
| Formula molecolare |
C7H13N |
| Peso Molecolare |
111.1848 |
| InChI |
InChI=1/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6?,7+/m1/s1 |
| Numero CAS |
497-37-0 |
| EINECS |
207-845-6 |
| Struttura molecolare |
|
| Densità |
0.985g/cm3 |
| Punto di fusione |
117-119℃ |
| Punto di ebollizione |
160°C at 760 mmHg |
| Indice di rifrazione |
1.512 |
| Punto d'infiammabilità |
35°C |
| Pressione di vapore |
2.44mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|