497-37-0 exo-(±)-Norborneol
| product Name |
exo-(±)-Norborneol |
| CAS No |
497-37-0 |
| Synonyms |
2-exo-Norborneol; exo-Norborneol; (1R,2R,4S)-bicyclo[2.2.1]heptan-2-ol; (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol; (2S,4R)-bicyclo[2.2.1]heptan-2-amine |
| Molecular Formula |
C7H13N |
| Molecular Weight |
111.1848 |
| InChI |
InChI=1/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6?,7+/m1/s1 |
| EINECS |
207-845-6 |
| Molecular Structure |
|
| Density |
0.985g/cm3 |
| Melting point |
117-119℃ |
| Boiling point |
160°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
35°C |
| Vapour Pressur |
2.44mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|