2571-52-0 Mesitonitrile
| Nome del prodotto |
Mesitonitrile |
| Nome inglese |
Mesitonitrile; 2,4,6-Trimethylbenzonitrile; Cyanomesitylene |
| Formula molecolare |
C10H11N |
| Peso Molecolare |
145.201 |
| InChI |
InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
| Numero CAS |
2571-52-0 |
| Struttura molecolare |
|
| Densità |
0.97g/cm3 |
| Punto di ebollizione |
260.3°C at 760 mmHg |
| Indice di rifrazione |
1.521 |
| Punto d'infiammabilità |
111.3°C |
| Pressione di vapore |
0.0123mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|