2571-52-0 Mesitonitrile
| product Name |
Mesitonitrile |
| CAS No |
2571-52-0 |
| Synonyms |
2,4,6-Trimethylbenzonitrile; Cyanomesitylene |
| Molecular Formula |
C10H11N |
| Molecular Weight |
145.201 |
| InChI |
InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Boiling point |
260.3°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
111.3°C |
| Vapour Pressur |
0.0123mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |