23708-56-7 6-undecanol
| Nome del prodotto |
6-undecanol |
| Nome inglese |
6-undecanol; Undecanol; Di-n-amyl carbinol~Di-n-pentyl carbinol; undecan-6-ol |
| Formula molecolare |
C11H24O |
| Peso Molecolare |
172.3077 |
| InChI |
InChI=1/C11H24O/c1-3-5-7-9-11(12)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| Numero CAS |
23708-56-7 |
| EINECS |
245-837-4 |
| Struttura molecolare |
|
| Densità |
0.828g/cm3 |
| Punto di ebollizione |
229.7°C at 760 mmHg |
| Indice di rifrazione |
1.437 |
| Punto d'infiammabilità |
94°C |
| Pressione di vapore |
0.0132mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|