23708-56-7 6-undecanol
| product Name |
6-undecanol |
| CAS No |
23708-56-7 |
| Synonyms |
Undecanol; Di-n-amyl carbinol~Di-n-pentyl carbinol; undecan-6-ol |
| Molecular Formula |
C11H24O |
| Molecular Weight |
172.3077 |
| InChI |
InChI=1/C11H24O/c1-3-5-7-9-11(12)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| EINECS |
245-837-4 |
| Molecular Structure |
|
| Density |
0.828g/cm3 |
| Boiling point |
229.7°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
94°C |
| Vapour Pressur |
0.0132mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|